C18H13N2O3- — CID 7095190
(3S)-3-(4-cyanophenyl)-3-(3-oxo-1H-isoindol-2-yl)propanoate (PubChem CID 7095190) has the molecular formula C18H13N2O3- and a molecular weight of 305.31 g/mol. Its IUPAC name is (3S)-3-(4-cyanophenyl)-3-(3-oxo-1H-isoindol-2-yl)propanoate.
| Compound Name | (3S)-3-(4-cyanophenyl)-3-(3-oxo-1H-isoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 7095190 |
| Molecular Formula | C18H13N2O3- |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (3S)-3-(4-cyanophenyl)-3-(3-oxo-1H-isoindol-2-yl)propanoate |
| SMILES | N#Cc1ccc([C@H](CC(=O)[O-])N2Cc3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C18H14N2O3/c19-10-12-5-7-13(8-6-12)16(9-17(21)22)20-11-14-3-1-2-4-15(14)18(20)23/h1-8,16H,9,11H2,(H,21,22)/p-1/t16-/m0/s1 |
| InChIKey | OUCJFSOWHZMGPD-INIZCTEOSA-M |
| XLogP | 1.40 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |