C26H32N8O — CID 70954747
1-(6-methyl-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9(21),10,12,16(20),17-nonaen-12-yl)-3-(2-piperazin-1-ylethyl)urea (PubChem CID 70954747) has the molecular formula C26H32N8O and a molecular weight of 472.60 g/mol. Its IUPAC name is 1-(6-methyl-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9(21),10,12,16(20),17-nonaen-12-yl)-3-(2-piperazin-1-ylethyl)urea.
| Compound Name | 1-(6-methyl-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9(21),10,12,16(20),17-nonaen-12-yl)-3-(2-piperazin-1-ylethyl)urea |
|---|---|
| PubChem CID | 70954747 |
| Molecular Formula | C26H32N8O |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 1-(6-methyl-2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9(21),10,12,16(20),17-nonaen-12-yl)-3-(2-piperazin-1-ylethyl)urea |
| SMILES | Cc1cnc2nc1Nc1ccc(NC(=O)NCCN3CCNCC3)c(c1)CCc1cccc(c1)N2 |
| InChI | InChI=1S/C26H32N8O/c1-18-17-29-25-31-21-4-2-3-19(15-21)5-6-20-16-22(30-24(18)33-25)7-8-23(20)32-26(35)28-11-14-34-12-9-27-10-13-34/h2-4,7-8,15-17,27H,5-6,9-14H2,1H3,(H2,28,32,35)(H2,29,30,31,33) |
| InChIKey | HTIJGBXMDWGADS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |