C24H27FN8O — CID 166870936
5-fluoro-11-methyl-1,4,7,9,13,22,24,30-octazapentacyclo[22.2.2.12,6.18,12.114,18]hentriaconta-2(31),3,5,8,10,12(30),14,16,18(29)-nonaen-23-one (PubChem CID 166870936) has the molecular formula C24H27FN8O and a molecular weight of 462.53 g/mol. Its IUPAC name is 5-fluoro-11-methyl-1,4,7,9,13,22,24,30-octazapentacyclo[22.2.2.12,6.18,12.114,18]hentriaconta-2(31),3,5,8,10,12(30),14,16,18(29)-nonaen-23-one.
| Compound Name | 5-fluoro-11-methyl-1,4,7,9,13,22,24,30-octazapentacyclo[22.2.2.12,6.18,12.114,18]hentriaconta-2(31),3,5,8,10,12(30),14,16,18(29)-nonaen-23-one |
|---|---|
| PubChem CID | 166870936 |
| Molecular Formula | C24H27FN8O |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 5-fluoro-11-methyl-1,4,7,9,13,22,24,30-octazapentacyclo[22.2.2.12,6.18,12.114,18]hentriaconta-2(31),3,5,8,10,12(30),14,16,18(29)-nonaen-23-one |
| SMILES | Cc1cnc2nc1Nc1cccc(c1)CCCNC(=O)N1CCN(CC1)c1cnc(F)c(c1)N2 |
| InChI | InChI=1S/C24H27FN8O/c1-16-14-28-23-30-20-13-19(15-27-21(20)25)32-8-10-33(11-9-32)24(34)26-7-3-5-17-4-2-6-18(12-17)29-22(16)31-23/h2,4,6,12-15H,3,5,7-11H2,1H3,(H,26,34)(H2,28,29,30,31) |
| InChIKey | URDXFCMNGAOSRZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|