C22H22FN7O3 — CID 168776505
5-fluoro-11-methyl-22-nitro-4,7,9,13,19,26-hexazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8,10,12(26),21,24-nonaen-20-one (PubChem CID 168776505) has the molecular formula C22H22FN7O3 and a molecular weight of 451.46 g/mol. Its IUPAC name is 5-fluoro-11-methyl-22-nitro-4,7,9,13,19,26-hexazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8,10,12(26),21,24-nonaen-20-one.
| Compound Name | 5-fluoro-11-methyl-22-nitro-4,7,9,13,19,26-hexazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8,10,12(26),21,24-nonaen-20-one |
|---|---|
| PubChem CID | 168776505 |
| Molecular Formula | C22H22FN7O3 |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 5-fluoro-11-methyl-22-nitro-4,7,9,13,19,26-hexazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8,10,12(26),21,24-nonaen-20-one |
| SMILES | Cc1cnc2nc1NCCCCCNC(=O)c1ccc(cc1[N+](=O)[O-])-c1cnc(F)c(c1)N2 |
| InChI | InChI=1S/C22H22FN7O3/c1-13-11-27-22-28-17-9-15(12-26-19(17)23)14-5-6-16(18(10-14)30(32)33)21(31)25-8-4-2-3-7-24-20(13)29-22/h5-6,9-12H,2-4,7-8H2,1H3,(H,25,31)(H2,24,27,28,29) |
| InChIKey | HFUZJXNRDOPLNQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 134.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|