C27H30N6O4 — CID 170002094
23-nitro-10-piperidin-1-yl-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8,10,12(26),21,24-nonaen-20-one (PubChem CID 170002094) has the molecular formula C27H30N6O4 and a molecular weight of 502.58 g/mol. Its IUPAC name is 23-nitro-10-piperidin-1-yl-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8,10,12(26),21,24-nonaen-20-one.
| Compound Name | 23-nitro-10-piperidin-1-yl-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8,10,12(26),21,24-nonaen-20-one |
|---|---|
| PubChem CID | 170002094 |
| Molecular Formula | C27H30N6O4 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 23-nitro-10-piperidin-1-yl-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8,10,12(26),21,24-nonaen-20-one |
| SMILES | O=C1NCCCCOCc2cc(cc(N3CCCCC3)c2)Nc2nccc(n2)-c2ccc1cc2[N+](=O)[O-] |
| InChI | InChI=1S/C27H30N6O4/c34-26-20-6-7-23(25(16-20)33(35)36)24-8-10-29-27(31-24)30-21-14-19(18-37-13-5-2-9-28-26)15-22(17-21)32-11-3-1-4-12-32/h6-8,10,14-17H,1-5,9,11-13,18H2,(H,28,34)(H,29,30,31) |
| InChIKey | XBWFJCXYUMSWQU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|