C27H29N5O6 — CID 170003045
23-nitro-11-(oxan-3-yloxy)-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one (PubChem CID 170003045) has the molecular formula C27H29N5O6 and a molecular weight of 519.56 g/mol. Its IUPAC name is 23-nitro-11-(oxan-3-yloxy)-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one.
| Compound Name | 23-nitro-11-(oxan-3-yloxy)-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one |
|---|---|
| PubChem CID | 170003045 |
| Molecular Formula | C27H29N5O6 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 23-nitro-11-(oxan-3-yloxy)-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one |
| SMILES | O=C1NCCCCOCc2cc(ccc2OC2CCCOC2)Nc2nccc(n2)-c2ccc1cc2[N+](=O)[O-] |
| InChI | InChI=1S/C27H29N5O6/c33-26-18-5-7-22(24(15-18)32(34)35)23-9-11-29-27(31-23)30-20-6-8-25(38-21-4-3-13-37-17-21)19(14-20)16-36-12-2-1-10-28-26/h5-9,11,14-15,21H,1-4,10,12-13,16-17H2,(H,28,33)(H,29,30,31) |
| InChIKey | XRCQLEZGWXCZHP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|