C26H28N6O4S — CID 170004171
23-nitro-10-thiomorpholin-4-yl-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8,10,12(26),21,24-nonaen-20-one (PubChem CID 170004171) has the molecular formula C26H28N6O4S and a molecular weight of 520.62 g/mol. Its IUPAC name is 23-nitro-10-thiomorpholin-4-yl-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8,10,12(26),21,24-nonaen-20-one.
| Compound Name | 23-nitro-10-thiomorpholin-4-yl-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8,10,12(26),21,24-nonaen-20-one |
|---|---|
| PubChem CID | 170004171 |
| Molecular Formula | C26H28N6O4S |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | 23-nitro-10-thiomorpholin-4-yl-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8,10,12(26),21,24-nonaen-20-one |
| SMILES | O=C1NCCCCOCc2cc(cc(N3CCSCC3)c2)Nc2nccc(n2)-c2ccc1cc2[N+](=O)[O-] |
| InChI | InChI=1S/C26H28N6O4S/c33-25-19-3-4-22(24(15-19)32(34)35)23-5-7-28-26(30-23)29-20-13-18(17-36-10-2-1-6-27-25)14-21(16-20)31-8-11-37-12-9-31/h3-5,7,13-16H,1-2,6,8-12,17H2,(H,27,33)(H,28,29,30) |
| InChIKey | CNYQUGKGTXLRPA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|