C28H26FN5O3 — CID 166871845
23-amino-11-(2-fluorophenoxy)-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one (PubChem CID 166871845) has the molecular formula C28H26FN5O3 and a molecular weight of 499.55 g/mol. Its IUPAC name is 23-amino-11-(2-fluorophenoxy)-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one.
| Compound Name | 23-amino-11-(2-fluorophenoxy)-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one |
|---|---|
| PubChem CID | 166871845 |
| Molecular Formula | C28H26FN5O3 |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 23-amino-11-(2-fluorophenoxy)-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one |
| SMILES | Nc1cc2ccc1-c1ccnc(n1)Nc1ccc(Oc3ccccc3F)c(c1)COCCCCNC2=O |
| InChI | InChI=1S/C28H26FN5O3/c29-22-5-1-2-6-26(22)37-25-10-8-20-15-19(25)17-36-14-4-3-12-31-27(35)18-7-9-21(23(30)16-18)24-11-13-32-28(33-20)34-24/h1-2,5-11,13,15-16H,3-4,12,14,17,30H2,(H,31,35)(H,32,33,34) |
| InChIKey | BZRJKGYKSXUJFO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|