C30H31ClFN5O4 — CID 170003454
23-amino-11-[(2-chloro-4-fluoro-6-methoxyphenyl)methoxy]-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-ol (PubChem CID 170003454) has the molecular formula C30H31ClFN5O4 and a molecular weight of 580.06 g/mol. Its IUPAC name is 23-amino-11-[(2-chloro-4-fluoro-6-methoxyphenyl)methoxy]-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-ol.
| Compound Name | 23-amino-11-[(2-chloro-4-fluoro-6-methoxyphenyl)methoxy]-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-ol |
|---|---|
| PubChem CID | 170003454 |
| Molecular Formula | C30H31ClFN5O4 |
| Molecular Weight | 580.06 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | 23-amino-11-[(2-chloro-4-fluoro-6-methoxyphenyl)methoxy]-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-ol |
| SMILES | COc1cc(F)cc(Cl)c1COc1ccc2cc1COCCCCNC(O)c1ccc(c(N)c1)-c1ccnc(n1)N2 |
| InChI | InChI=1S/C30H31ClFN5O4/c1-39-28-15-20(32)14-24(31)23(28)17-41-27-7-5-21-12-19(27)16-40-11-3-2-9-34-29(38)18-4-6-22(25(33)13-18)26-8-10-35-30(36-21)37-26/h4-8,10,12-15,29,34,38H,2-3,9,11,16-17,33H2,1H3,(H,35,36,37) |
| InChIKey | QRBALJMTVKLYIT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.06 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|