C31H32FN5O4 — CID 166871395
(17S)-23-amino-11-[(2-fluoro-6-methoxyphenyl)methoxy]-17-methyl-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one (PubChem CID 166871395) has the molecular formula C31H32FN5O4 and a molecular weight of 557.63 g/mol. Its IUPAC name is (17S)-23-amino-11-[(2-fluoro-6-methoxyphenyl)methoxy]-17-methyl-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one.
| Compound Name | (17S)-23-amino-11-[(2-fluoro-6-methoxyphenyl)methoxy]-17-methyl-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one |
|---|---|
| PubChem CID | 166871395 |
| Molecular Formula | C31H32FN5O4 |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | (17S)-23-amino-11-[(2-fluoro-6-methoxyphenyl)methoxy]-17-methyl-14-oxa-5,7,19,27-tetrazatetracyclo[19.2.2.12,6.18,12]heptacosa-1(23),2(27),3,5,8(26),9,11,21,24-nonaen-20-one |
| SMILES | COc1cccc(F)c1COc1ccc2cc1COCC[C@H](C)CNC(=O)c1ccc(c(N)c1)-c1ccnc(n1)N2 |
| InChI | InChI=1S/C31H32FN5O4/c1-19-11-13-40-17-21-14-22(7-9-28(21)41-18-24-25(32)4-3-5-29(24)39-2)36-31-34-12-10-27(37-31)23-8-6-20(15-26(23)33)30(38)35-16-19/h3-10,12,14-15,19H,11,13,16-18,33H2,1-2H3,(H,35,38)(H,34,36,37)/t19-/m0/s1 |
| InChIKey | OYWXVOWWCCQUAL-IBGZPJMESA-N |
| XLogP | 5.48 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|