C20H20N6O — CID 10044068
5,7,15,19,21,26-hexazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(24),2(26),3,5,8,10,12(25),20,22-nonaen-14-one (PubChem CID 10044068) has the molecular formula C20H20N6O and a molecular weight of 360.42 g/mol. Its IUPAC name is 5,7,15,19,21,26-hexazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(24),2(26),3,5,8,10,12(25),20,22-nonaen-14-one.
| Compound Name | 5,7,15,19,21,26-hexazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(24),2(26),3,5,8,10,12(25),20,22-nonaen-14-one |
|---|---|
| PubChem CID | 10044068 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 5,7,15,19,21,26-hexazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(24),2(26),3,5,8,10,12(25),20,22-nonaen-14-one |
| SMILES | O=C1Cc2cccc(c2)Nc2nccc(n2)-c2ccnc(c2)NCCCN1 |
| InChI | InChI=1S/C20H20N6O/c27-19-12-14-3-1-4-16(11-14)25-20-24-10-6-17(26-20)15-5-9-22-18(13-15)21-7-2-8-23-19/h1,3-6,9-11,13H,2,7-8,12H2,(H,21,22)(H,23,27)(H,24,25,26) |
| InChIKey | SSDQZGSSWCJEDO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |