C26H32N8O — CID 118427717
16-methyl-5,7,14,17,20,24,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-19-one (PubChem CID 118427717) has the molecular formula C26H32N8O and a molecular weight of 472.60 g/mol. Its IUPAC name is 16-methyl-5,7,14,17,20,24,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-19-one.
| Compound Name | 16-methyl-5,7,14,17,20,24,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-19-one |
|---|---|
| PubChem CID | 118427717 |
| Molecular Formula | C26H32N8O |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 16-methyl-5,7,14,17,20,24,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-19-one |
| SMILES | CC1CN2CCN1CC(=O)NCCCNc1ccc(cn1)-c1ccnc(n1)Nc1cccc(c1)C2 |
| InChI | InChI=1S/C26H32N8O/c1-19-16-33-12-13-34(19)18-25(35)28-10-3-9-27-24-7-6-21(15-30-24)23-8-11-29-26(32-23)31-22-5-2-4-20(14-22)17-33/h2,4-8,11,14-15,19H,3,9-10,12-13,16-18H2,1H3,(H,27,30)(H,28,35)(H,29,31,32) |
| InChIKey | XQKRPIJSBLOCLT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |