C27H36N8 — CID 123266067
20,24-dimethyl-5,7,14,17,20,24,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaene (PubChem CID 123266067) has the molecular formula C27H36N8 and a molecular weight of 472.64 g/mol. Its IUPAC name is 20,24-dimethyl-5,7,14,17,20,24,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaene.
| Compound Name | 20,24-dimethyl-5,7,14,17,20,24,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaene |
|---|---|
| PubChem CID | 123266067 |
| Molecular Formula | C27H36N8 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | 20,24-dimethyl-5,7,14,17,20,24,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaene |
| SMILES | CN1CCCN(C)c2ccc(cn2)-c2ccnc(n2)Nc2cccc(c2)CN2CCN(CC1)CC2 |
| InChI | InChI=1S/C27H36N8/c1-32-11-4-12-33(2)26-8-7-23(20-29-26)25-9-10-28-27(31-25)30-24-6-3-5-22(19-24)21-35-17-15-34(14-13-32)16-18-35/h3,5-10,19-20H,4,11-18,21H2,1-2H3,(H,28,30,31) |
| InChIKey | LBASKZJPXCYWCU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |