C35H50N8O2 — CID 134238415
4-[2-[(20,24-dimethyl-5,7,14,17,24,26,33-heptazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-15-yl)methoxy]ethyl]morpholine (PubChem CID 134238415) has the molecular formula C35H50N8O2 and a molecular weight of 614.84 g/mol. Its IUPAC name is 4-[2-[(20,24-dimethyl-5,7,14,17,24,26,33-heptazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-15-yl)methoxy]ethyl]morpholine.
| Compound Name | 4-[2-[(20,24-dimethyl-5,7,14,17,24,26,33-heptazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-15-yl)methoxy]ethyl]morpholine |
|---|---|
| PubChem CID | 134238415 |
| Molecular Formula | C35H50N8O2 |
| Molecular Weight | 614.84 g/mol |
| Exact Mass | 614.41 |
| IUPAC Name | 4-[2-[(20,24-dimethyl-5,7,14,17,24,26,33-heptazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-15-yl)methoxy]ethyl]morpholine |
| SMILES | CC1CCCN(C)c2ccc(cn2)-c2ccnc(n2)Nc2cccc(c2)CN2CCN(CC1)CC2COCCN1CCOCC1 |
| InChI | InChI=1S/C35H50N8O2/c1-28-5-4-13-40(2)34-9-8-30(24-37-34)33-10-12-36-35(39-33)38-31-7-3-6-29(23-31)25-43-16-15-42(14-11-28)26-32(43)27-45-22-19-41-17-20-44-21-18-41/h3,6-10,12,23-24,28,32H,4-5,11,13-22,25-27H2,1-2H3,(H,36,38,39) |
| InChIKey | SMZHISSEXIWNNS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.84 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|