C35H52N8O3Si — CID 140768444
15-(methoxymethyl)-20,24-dimethyl-7-(2-trimethylsilylethoxymethyl)-5,7,14,17,20,24,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-19-one (PubChem CID 140768444) has the molecular formula C35H52N8O3Si and a molecular weight of 660.94 g/mol. Its IUPAC name is 15-(methoxymethyl)-20,24-dimethyl-7-(2-trimethylsilylethoxymethyl)-5,7,14,17,20,24,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-19-one.
| Compound Name | 15-(methoxymethyl)-20,24-dimethyl-7-(2-trimethylsilylethoxymethyl)-5,7,14,17,20,24,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-19-one |
|---|---|
| PubChem CID | 140768444 |
| Molecular Formula | C35H52N8O3Si |
| Molecular Weight | 660.94 g/mol |
| Exact Mass | 660.39 |
| IUPAC Name | 15-(methoxymethyl)-20,24-dimethyl-7-(2-trimethylsilylethoxymethyl)-5,7,14,17,20,24,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-19-one |
| SMILES | COCC1CN2CCN1Cc1cccc(c1)N(COCC[Si](C)(C)C)c1nccc(n1)-c1ccc(nc1)N(C)CCCN(C)C(=O)C2 |
| InChI | InChI=1S/C35H52N8O3Si/c1-39-15-8-16-40(2)34(44)25-41-17-18-42(31(24-41)26-45-3)23-28-9-7-10-30(21-28)43(27-46-19-20-47(4,5)6)35-36-14-13-32(38-35)29-11-12-33(39)37-22-29/h7,9-14,21-22,31H,8,15-20,23-27H2,1-6H3 |
| InChIKey | CBHUHBAAMIQDGR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.94 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|