C29H35N7O2 — CID 143861815
4-methoxy-18,21-dimethyl-1,8,10,16,18,21,32-heptazapentacyclo[22.3.2.214,17.13,7.19,13]tritriaconta-3,5,7(33),9,11,13(32),14,16,24,30-decaen-22-one (PubChem CID 143861815) has the molecular formula C29H35N7O2 and a molecular weight of 513.65 g/mol. Its IUPAC name is 4-methoxy-18,21-dimethyl-1,8,10,16,18,21,32-heptazapentacyclo[22.3.2.214,17.13,7.19,13]tritriaconta-3,5,7(33),9,11,13(32),14,16,24,30-decaen-22-one.
| Compound Name | 4-methoxy-18,21-dimethyl-1,8,10,16,18,21,32-heptazapentacyclo[22.3.2.214,17.13,7.19,13]tritriaconta-3,5,7(33),9,11,13(32),14,16,24,30-decaen-22-one |
|---|---|
| PubChem CID | 143861815 |
| Molecular Formula | C29H35N7O2 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | 4-methoxy-18,21-dimethyl-1,8,10,16,18,21,32-heptazapentacyclo[22.3.2.214,17.13,7.19,13]tritriaconta-3,5,7(33),9,11,13(32),14,16,24,30-decaen-22-one |
| SMILES | COc1ccc2cc1CN1CCC=C(CC1)CC(=O)N(C)CCN(C)c1ccc(cn1)-c1ccnc(n1)N2 |
| InChI | InChI=1S/C29H35N7O2/c1-34-15-16-35(2)28(37)17-21-5-4-13-36(14-11-21)20-23-18-24(7-8-26(23)38-3)32-29-30-12-10-25(33-29)22-6-9-27(34)31-19-22/h5-10,12,18-19H,4,11,13-17,20H2,1-3H3,(H,30,32,33) |
| InChIKey | KOBJUUDSFRWLCG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|