C31H39N5O3 — CID 58102769
5,17-dimethoxy-20-methyl-1,8,10,20,32-pentazapentacyclo[24.2.2.13,7.19,13.114,18]tritriaconta-3(33),4,6,9,11,13(32),14(31),15,17-nonaen-25-one (PubChem CID 58102769) has the molecular formula C31H39N5O3 and a molecular weight of 529.69 g/mol. Its IUPAC name is 5,17-dimethoxy-20-methyl-1,8,10,20,32-pentazapentacyclo[24.2.2.13,7.19,13.114,18]tritriaconta-3(33),4,6,9,11,13(32),14(31),15,17-nonaen-25-one.
| Compound Name | 5,17-dimethoxy-20-methyl-1,8,10,20,32-pentazapentacyclo[24.2.2.13,7.19,13.114,18]tritriaconta-3(33),4,6,9,11,13(32),14(31),15,17-nonaen-25-one |
|---|---|
| PubChem CID | 58102769 |
| Molecular Formula | C31H39N5O3 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | 5,17-dimethoxy-20-methyl-1,8,10,20,32-pentazapentacyclo[24.2.2.13,7.19,13.114,18]tritriaconta-3(33),4,6,9,11,13(32),14(31),15,17-nonaen-25-one |
| SMILES | COc1cc2cc(c1)Nc1nccc(n1)-c1ccc(OC)c(c1)CN(C)CCCCC(=O)C1CCN(CC1)C2 |
| InChI | InChI=1S/C31H39N5O3/c1-35-13-5-4-6-29(37)23-10-14-36(15-11-23)20-22-16-26(19-27(17-22)38-2)33-31-32-12-9-28(34-31)24-7-8-30(39-3)25(18-24)21-35/h7-9,12,16-19,23H,4-6,10-11,13-15,20-21H2,1-3H3,(H,32,33,34) |
| InChIKey | IFXYJLLJUSXNQN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |