C26H31N5O2 — CID 143464439
(9E,15E)-21-methoxy-18-methyl-8-methylidene-10-[(Z)-prop-1-enyl]-5,7,11,18,25-pentazatricyclo[18.3.1.12,6]pentacosa-1(24),2(25),3,5,9,15,20,22-octaen-12-one (PubChem CID 143464439) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is (9E,15E)-21-methoxy-18-methyl-8-methylidene-10-[(Z)-prop-1-enyl]-5,7,11,18,25-pentazatricyclo[18.3.1.12,6]pentacosa-1(24),2(25),3,5,9,15,20,22-octaen-12-one.
| Compound Name | (9E,15E)-21-methoxy-18-methyl-8-methylidene-10-[(Z)-prop-1-enyl]-5,7,11,18,25-pentazatricyclo[18.3.1.12,6]pentacosa-1(24),2(25),3,5,9,15,20,22-octaen-12-one |
|---|---|
| PubChem CID | 143464439 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | (9E,15E)-21-methoxy-18-methyl-8-methylidene-10-[(Z)-prop-1-enyl]-5,7,11,18,25-pentazatricyclo[18.3.1.12,6]pentacosa-1(24),2(25),3,5,9,15,20,22-octaen-12-one |
| SMILES | C=C1/C=C(\C=C/C)NC(=O)CC/C=C/CN(C)Cc2cc(ccc2OC)-c2ccnc(n2)N1 |
| InChI | InChI=1S/C26H31N5O2/c1-5-9-22-16-19(2)28-26-27-14-13-23(30-26)20-11-12-24(33-4)21(17-20)18-31(3)15-8-6-7-10-25(32)29-22/h5-6,8-9,11-14,16-17H,2,7,10,15,18H2,1,3-4H3,(H,29,32)(H,27,28,30)/b8-6+,9-5-,22-16+ |
| InChIKey | IKDMCWJKRBDERR-GWAMZLGJSA-N |
| XLogP | 4.44 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|