C31H42N6O2 — CID 143861764
5,17-dimethoxy-20-methyl-1,8,10,20,27,33-hexazapentacyclo[25.2.2.13,7.19,13.114,18]tetratriaconta-3(34),4,6,9,11,13(33),14(32),15,17-nonaene (PubChem CID 143861764) has the molecular formula C31H42N6O2 and a molecular weight of 530.72 g/mol. Its IUPAC name is 5,17-dimethoxy-20-methyl-1,8,10,20,27,33-hexazapentacyclo[25.2.2.13,7.19,13.114,18]tetratriaconta-3(34),4,6,9,11,13(33),14(32),15,17-nonaene.
| Compound Name | 5,17-dimethoxy-20-methyl-1,8,10,20,27,33-hexazapentacyclo[25.2.2.13,7.19,13.114,18]tetratriaconta-3(34),4,6,9,11,13(33),14(32),15,17-nonaene |
|---|---|
| PubChem CID | 143861764 |
| Molecular Formula | C31H42N6O2 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | 5,17-dimethoxy-20-methyl-1,8,10,20,27,33-hexazapentacyclo[25.2.2.13,7.19,13.114,18]tetratriaconta-3(34),4,6,9,11,13(33),14(32),15,17-nonaene |
| SMILES | COc1cc2cc(c1)Nc1nccc(n1)-c1ccc(OC)c(c1)CN(C)CCCCCCN1CCN(CC1)C2 |
| InChI | InChI=1S/C31H42N6O2/c1-35-12-6-4-5-7-13-36-14-16-37(17-15-36)22-24-18-27(21-28(19-24)38-2)33-31-32-11-10-29(34-31)25-8-9-30(39-3)26(20-25)23-35/h8-11,18-21H,4-7,12-17,22-23H2,1-3H3,(H,32,33,34) |
| InChIKey | KOUBQQZJKZDHET-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 65.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |