C28H37N7O — CID 134238397
20,24-dimethyl-5,7,17,20,24,26,33-heptazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-14-ol (PubChem CID 134238397) has the molecular formula C28H37N7O and a molecular weight of 487.65 g/mol. Its IUPAC name is 20,24-dimethyl-5,7,17,20,24,26,33-heptazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-14-ol.
| Compound Name | 20,24-dimethyl-5,7,17,20,24,26,33-heptazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-14-ol |
|---|---|
| PubChem CID | 134238397 |
| Molecular Formula | C28H37N7O |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.31 |
| IUPAC Name | 20,24-dimethyl-5,7,17,20,24,26,33-heptazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-14-ol |
| SMILES | CN1CCCN(C)c2ccc(cn2)-c2ccnc(n2)Nc2cccc(c2)CC2(O)CCN(CC1)CC2 |
| InChI | InChI=1S/C28H37N7O/c1-33-13-4-14-34(2)26-8-7-23(21-30-26)25-9-12-29-27(32-25)31-24-6-3-5-22(19-24)20-28(36)10-15-35(16-11-28)18-17-33/h3,5-9,12,19,21,36H,4,10-11,13-18,20H2,1-2H3,(H,29,31,32) |
| InChIKey | ACZCWEPDLIBEKJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |