C26H32N8O3S — CID 118427949
23-methylsulfonyl-5,7,14,17,20,23,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-19-one (PubChem CID 118427949) has the molecular formula C26H32N8O3S and a molecular weight of 536.66 g/mol. Its IUPAC name is 23-methylsulfonyl-5,7,14,17,20,23,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-19-one.
| Compound Name | 23-methylsulfonyl-5,7,14,17,20,23,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-19-one |
|---|---|
| PubChem CID | 118427949 |
| Molecular Formula | C26H32N8O3S |
| Molecular Weight | 536.66 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 23-methylsulfonyl-5,7,14,17,20,23,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-19-one |
| SMILES | CS(=O)(=O)N1CCNC(=O)CN2CCN(CC2)Cc2cccc(c2)Nc2nccc(n2)-c2ccc(nc2)C1 |
| InChI | InChI=1S/C26H32N8O3S/c1-38(36,37)34-10-9-27-25(35)19-33-13-11-32(12-14-33)17-20-3-2-4-22(15-20)30-26-28-8-7-24(31-26)21-5-6-23(18-34)29-16-21/h2-8,15-16H,9-14,17-19H2,1H3,(H,27,35)(H,28,30,31) |
| InChIKey | VUZLHQFYHAZQNC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.66 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |