C31H39N7O2 — CID 146927022
23-(oxolan-2-ylmethyl)-5,7,14,17,23,26,33-heptazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-19-one (PubChem CID 146927022) has the molecular formula C31H39N7O2 and a molecular weight of 541.70 g/mol. Its IUPAC name is 23-(oxolan-2-ylmethyl)-5,7,14,17,23,26,33-heptazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-19-one.
| Compound Name | 23-(oxolan-2-ylmethyl)-5,7,14,17,23,26,33-heptazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-19-one |
|---|---|
| PubChem CID | 146927022 |
| Molecular Formula | C31H39N7O2 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | 23-(oxolan-2-ylmethyl)-5,7,14,17,23,26,33-heptazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaen-19-one |
| SMILES | O=C1CCCN(CC2CCCO2)Cc2ccc(cn2)-c2ccnc(n2)Nc2cccc(c2)CN2CCN(CC2)C1 |
| InChI | InChI=1S/C31H39N7O2/c39-28-6-2-12-38(23-29-7-3-17-40-29)21-27-9-8-25(19-33-27)30-10-11-32-31(35-30)34-26-5-1-4-24(18-26)20-36-13-15-37(22-28)16-14-36/h1,4-5,8-11,18-19,29H,2-3,6-7,12-17,20-23H2,(H,32,34,35) |
| InChIKey | AEGVJAJZGHPHRK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |