C28H33N5O3 — CID 118930341
11-[4-(cyclopropylmethyl)piperazin-1-yl]-13,16,19-trioxa-5,7,26-triazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(24),2(26),3,5,8(25),9,11,20,22-nonaene (PubChem CID 118930341) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is 11-[4-(cyclopropylmethyl)piperazin-1-yl]-13,16,19-trioxa-5,7,26-triazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(24),2(26),3,5,8(25),9,11,20,22-nonaene.
| Compound Name | 11-[4-(cyclopropylmethyl)piperazin-1-yl]-13,16,19-trioxa-5,7,26-triazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(24),2(26),3,5,8(25),9,11,20,22-nonaene |
|---|---|
| PubChem CID | 118930341 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 11-[4-(cyclopropylmethyl)piperazin-1-yl]-13,16,19-trioxa-5,7,26-triazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(24),2(26),3,5,8(25),9,11,20,22-nonaene |
| SMILES | c1cc2cc(c1)-c1ccnc(n1)Nc1ccc(N3CCN(CC4CC4)CC3)c(c1)OCCOCCO2 |
| InChI | InChI=1S/C28H33N5O3/c1-2-22-18-24(3-1)35-16-14-34-15-17-36-27-19-23(30-28-29-9-8-25(22)31-28)6-7-26(27)33-12-10-32(11-13-33)20-21-4-5-21/h1-3,6-9,18-19,21H,4-5,10-17,20H2,(H,29,30,31) |
| InChIKey | HGQSRXNBFARUFU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 71.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|