C30H38N6O3 — CID 118930337
11-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-13,16,19-trioxa-5,7,26-triazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(24),2(26),3,5,8(25),9,11,20,22-nonaene (PubChem CID 118930337) has the molecular formula C30H38N6O3 and a molecular weight of 530.67 g/mol. Its IUPAC name is 11-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-13,16,19-trioxa-5,7,26-triazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(24),2(26),3,5,8(25),9,11,20,22-nonaene.
| Compound Name | 11-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-13,16,19-trioxa-5,7,26-triazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(24),2(26),3,5,8(25),9,11,20,22-nonaene |
|---|---|
| PubChem CID | 118930337 |
| Molecular Formula | C30H38N6O3 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | 11-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-13,16,19-trioxa-5,7,26-triazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(24),2(26),3,5,8(25),9,11,20,22-nonaene |
| SMILES | CN1CCN(C2CCN(c3ccc4cc3OCCOCCOc3cccc(c3)-c3ccnc(n3)N4)CC2)CC1 |
| InChI | InChI=1S/C30H38N6O3/c1-34-13-15-35(16-14-34)25-8-11-36(12-9-25)28-6-5-24-22-29(28)39-20-18-37-17-19-38-26-4-2-3-23(21-26)27-7-10-31-30(32-24)33-27/h2-7,10,21-22,25H,8-9,11-20H2,1H3,(H,31,32,33) |
| InChIKey | BXIVAVIMFMRSQF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 75.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|