C29H33N5O4 — CID 131974088
6-[4-(oxetan-3-yl)piperazin-1-yl]-8,11,14-trioxa-2,23,24-triazapentacyclo[13.8.4.13,7.018,26.021,25]octacosa-1(23),3(28),4,6,15(27),16,18(26),21,24-nonaene (PubChem CID 131974088) has the molecular formula C29H33N5O4 and a molecular weight of 515.61 g/mol. Its IUPAC name is 6-[4-(oxetan-3-yl)piperazin-1-yl]-8,11,14-trioxa-2,23,24-triazapentacyclo[13.8.4.13,7.018,26.021,25]octacosa-1(23),3(28),4,6,15(27),16,18(26),21,24-nonaene.
| Compound Name | 6-[4-(oxetan-3-yl)piperazin-1-yl]-8,11,14-trioxa-2,23,24-triazapentacyclo[13.8.4.13,7.018,26.021,25]octacosa-1(23),3(28),4,6,15(27),16,18(26),21,24-nonaene |
|---|---|
| PubChem CID | 131974088 |
| Molecular Formula | C29H33N5O4 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | 6-[4-(oxetan-3-yl)piperazin-1-yl]-8,11,14-trioxa-2,23,24-triazapentacyclo[13.8.4.13,7.018,26.021,25]octacosa-1(23),3(28),4,6,15(27),16,18(26),21,24-nonaene |
| SMILES | c1cc(N2CCN(C3COC3)CC2)c2cc1Nc1ncc3c(n1)-c1cc(ccc1CC3)OCCOCCO2 |
| InChI | InChI=1S/C29H33N5O4/c1-2-21-17-30-29-31-22-4-6-26(34-9-7-33(8-10-34)23-18-36-19-23)27(15-22)38-14-12-35-11-13-37-24-5-3-20(1)25(16-24)28(21)32-29/h3-6,15-17,23H,1-2,7-14,18-19H2,(H,30,31,32) |
| InChIKey | AWXMYSNJCJYHBR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 81.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|