C26H30N6O2 — CID 58102629
(16S)-16-methyl-11-morpholin-4-yl-5,7,14,17,26-pentazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(23),2(26),3,5,8(25),9,11,20(24),21-nonaen-15-one (PubChem CID 58102629) has the molecular formula C26H30N6O2 and a molecular weight of 458.57 g/mol. Its IUPAC name is (16S)-16-methyl-11-morpholin-4-yl-5,7,14,17,26-pentazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(23),2(26),3,5,8(25),9,11,20(24),21-nonaen-15-one.
| Compound Name | (16S)-16-methyl-11-morpholin-4-yl-5,7,14,17,26-pentazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(23),2(26),3,5,8(25),9,11,20(24),21-nonaen-15-one |
|---|---|
| PubChem CID | 58102629 |
| Molecular Formula | C26H30N6O2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | (16S)-16-methyl-11-morpholin-4-yl-5,7,14,17,26-pentazatetracyclo[18.3.1.12,6.18,12]hexacosa-1(23),2(26),3,5,8(25),9,11,20(24),21-nonaen-15-one |
| SMILES | C[C@@H]1NCCc2cccc(c2)-c2ccnc(n2)Nc2ccc(N3CCOCC3)c(c2)CNC1=O |
| InChI | InChI=1S/C26H30N6O2/c1-18-25(33)29-17-21-16-22(5-6-24(21)32-11-13-34-14-12-32)30-26-28-10-8-23(31-26)20-4-2-3-19(15-20)7-9-27-18/h2-6,8,10,15-16,18,27H,7,9,11-14,17H2,1H3,(H,29,33)(H,28,30,31)/t18-/m0/s1 |
| InChIKey | WRCXUOBQEIKDPV-SFHVURJKSA-N |
| XLogP | 2.87 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|