C22H24N6O2 — CID 70804602
(15S)-15-(hydroxymethyl)-5,7,14,17,22,27-hexazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),21,23-nonaen-16-one (PubChem CID 70804602) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is (15S)-15-(hydroxymethyl)-5,7,14,17,22,27-hexazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),21,23-nonaen-16-one.
| Compound Name | (15S)-15-(hydroxymethyl)-5,7,14,17,22,27-hexazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),21,23-nonaen-16-one |
|---|---|
| PubChem CID | 70804602 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (15S)-15-(hydroxymethyl)-5,7,14,17,22,27-hexazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),21,23-nonaen-16-one |
| SMILES | O=C1NCCCc2cc(ccn2)-c2ccnc(n2)Nc2cccc(c2)CN[C@H]1CO |
| InChI | InChI=1S/C22H24N6O2/c29-14-20-21(30)24-8-2-5-17-12-16(6-9-23-17)19-7-10-25-22(28-19)27-18-4-1-3-15(11-18)13-26-20/h1,3-4,6-7,9-12,20,26,29H,2,5,8,13-14H2,(H,24,30)(H,25,27,28)/t20-/m0/s1 |
| InChIKey | BHYZPWUFDISEPZ-FQEVSTJZSA-N |
| XLogP | 1.80 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |