C19H18N6O — CID 10043239
2,4,11,13,17,25-hexazatetracyclo[17.2.2.13,7.18,12]pentacosa-1(21),3,5,7(25),8(24),9,11,19,22-nonaen-18-one (PubChem CID 10043239) has the molecular formula C19H18N6O and a molecular weight of 346.39 g/mol. Its IUPAC name is 2,4,11,13,17,25-hexazatetracyclo[17.2.2.13,7.18,12]pentacosa-1(21),3,5,7(25),8(24),9,11,19,22-nonaen-18-one.
| Compound Name | 2,4,11,13,17,25-hexazatetracyclo[17.2.2.13,7.18,12]pentacosa-1(21),3,5,7(25),8(24),9,11,19,22-nonaen-18-one |
|---|---|
| PubChem CID | 10043239 |
| Molecular Formula | C19H18N6O |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2,4,11,13,17,25-hexazatetracyclo[17.2.2.13,7.18,12]pentacosa-1(21),3,5,7(25),8(24),9,11,19,22-nonaen-18-one |
| SMILES | O=C1NCCCNc2cc(ccn2)-c2ccnc(n2)Nc2ccc1cc2 |
| InChI | InChI=1S/C19H18N6O/c26-18-13-2-4-15(5-3-13)24-19-23-11-7-16(25-19)14-6-10-21-17(12-14)20-8-1-9-22-18/h2-7,10-12H,1,8-9H2,(H,20,21)(H,22,26)(H,23,24,25) |
| InChIKey | PENFEWCQFLXSPC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |