C27H35N7O2 — CID 70804640
(15S)-15-(hydroxymethyl)-20-methyl-10-(propan-2-ylamino)-5,7,14,17,20,28-hexazatetracyclo[20.2.2.12,6.18,12]octacosa-1(25),2(28),3,5,8,10,12(27),22(26),23-nonaen-16-one (PubChem CID 70804640) has the molecular formula C27H35N7O2 and a molecular weight of 489.62 g/mol. Its IUPAC name is (15S)-15-(hydroxymethyl)-20-methyl-10-(propan-2-ylamino)-5,7,14,17,20,28-hexazatetracyclo[20.2.2.12,6.18,12]octacosa-1(25),2(28),3,5,8,10,12(27),22(26),23-nonaen-16-one.
| Compound Name | (15S)-15-(hydroxymethyl)-20-methyl-10-(propan-2-ylamino)-5,7,14,17,20,28-hexazatetracyclo[20.2.2.12,6.18,12]octacosa-1(25),2(28),3,5,8,10,12(27),22(26),23-nonaen-16-one |
|---|---|
| PubChem CID | 70804640 |
| Molecular Formula | C27H35N7O2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | (15S)-15-(hydroxymethyl)-20-methyl-10-(propan-2-ylamino)-5,7,14,17,20,28-hexazatetracyclo[20.2.2.12,6.18,12]octacosa-1(25),2(28),3,5,8,10,12(27),22(26),23-nonaen-16-one |
| SMILES | CC(C)Nc1cc2cc(c1)Nc1nccc(n1)-c1ccc(cc1)CN(C)CCNC(=O)[C@H](CO)NC2 |
| InChI | InChI=1S/C27H35N7O2/c1-18(2)31-22-12-20-13-23(14-22)32-27-29-9-8-24(33-27)21-6-4-19(5-7-21)16-34(3)11-10-28-26(36)25(17-35)30-15-20/h4-9,12-14,18,25,30-31,35H,10-11,15-17H2,1-3H3,(H,28,36)(H,29,32,33)/t25-/m0/s1 |
| InChIKey | UOTMFEHBGDHIHK-VWLOTQADSA-N |
| XLogP | 2.72 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|