C27H32N8O2 — CID 118428093
20,24-dimethyl-5,7,14,17,20,24,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaene-13,19-dione (PubChem CID 118428093) has the molecular formula C27H32N8O2 and a molecular weight of 500.61 g/mol. Its IUPAC name is 20,24-dimethyl-5,7,14,17,20,24,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaene-13,19-dione.
| Compound Name | 20,24-dimethyl-5,7,14,17,20,24,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaene-13,19-dione |
|---|---|
| PubChem CID | 118428093 |
| Molecular Formula | C27H32N8O2 |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | 20,24-dimethyl-5,7,14,17,20,24,26,33-octazapentacyclo[23.2.2.214,17.12,6.18,12]tritriaconta-1(27),2(33),3,5,8,10,12(32),25,28-nonaene-13,19-dione |
| SMILES | CN1CCCN(C)c2ccc(cn2)-c2ccnc(n2)Nc2cccc(c2)C(=O)N2CCN(CC2)CC1=O |
| InChI | InChI=1S/C27H32N8O2/c1-32-11-4-12-33(2)25(36)19-34-13-15-35(16-14-34)26(37)20-5-3-6-22(17-20)30-27-28-10-9-23(31-27)21-7-8-24(32)29-18-21/h3,5-10,17-18H,4,11-16,19H2,1-2H3,(H,28,30,31) |
| InChIKey | YLEKOLFTVMISNL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |