C28H34N6O2 — CID 143861848
11-methoxy-19,22-dimethyl-5,7,14,19,22,24-hexazapentacyclo[21.2.2.214,17.12,6.18,12]hentriaconta-1(25),2(31),3,5,8(30),9,11,23,26-nonaen-18-one (PubChem CID 143861848) has the molecular formula C28H34N6O2 and a molecular weight of 486.62 g/mol. Its IUPAC name is 11-methoxy-19,22-dimethyl-5,7,14,19,22,24-hexazapentacyclo[21.2.2.214,17.12,6.18,12]hentriaconta-1(25),2(31),3,5,8(30),9,11,23,26-nonaen-18-one.
| Compound Name | 11-methoxy-19,22-dimethyl-5,7,14,19,22,24-hexazapentacyclo[21.2.2.214,17.12,6.18,12]hentriaconta-1(25),2(31),3,5,8(30),9,11,23,26-nonaen-18-one |
|---|---|
| PubChem CID | 143861848 |
| Molecular Formula | C28H34N6O2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | 11-methoxy-19,22-dimethyl-5,7,14,19,22,24-hexazapentacyclo[21.2.2.214,17.12,6.18,12]hentriaconta-1(25),2(31),3,5,8(30),9,11,23,26-nonaen-18-one |
| SMILES | COc1ccc2cc1CN1CCC(CC1)C(=O)N(C)CCN(C)c1ccc(cn1)-c1ccnc(c1)N2 |
| InChI | InChI=1S/C28H34N6O2/c1-32-14-15-33(2)28(35)20-9-12-34(13-10-20)19-23-16-24(5-6-25(23)36-3)31-26-17-21(8-11-29-26)22-4-7-27(32)30-18-22/h4-8,11,16-18,20H,9-10,12-15,19H2,1-3H3,(H,29,31) |
| InChIKey | BESUYIOSNANXQO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |