C26H26FN7O4 — CID 71715460
29-fluoro-10-methyl-32-oxa-2,8,12,16,25,27,30-heptazapentacyclo[24.3.1.13,7.16,10.120,24]tritriaconta-1(30),3(33),4,6,20(31),21,23,26,28-nonaene-9,11,17-trione (PubChem CID 71715460) has the molecular formula C26H26FN7O4 and a molecular weight of 519.54 g/mol. Its IUPAC name is 29-fluoro-10-methyl-32-oxa-2,8,12,16,25,27,30-heptazapentacyclo[24.3.1.13,7.16,10.120,24]tritriaconta-1(30),3(33),4,6,20(31),21,23,26,28-nonaene-9,11,17-trione.
| Compound Name | 29-fluoro-10-methyl-32-oxa-2,8,12,16,25,27,30-heptazapentacyclo[24.3.1.13,7.16,10.120,24]tritriaconta-1(30),3(33),4,6,20(31),21,23,26,28-nonaene-9,11,17-trione |
|---|---|
| PubChem CID | 71715460 |
| Molecular Formula | C26H26FN7O4 |
| Molecular Weight | 519.54 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 29-fluoro-10-methyl-32-oxa-2,8,12,16,25,27,30-heptazapentacyclo[24.3.1.13,7.16,10.120,24]tritriaconta-1(30),3(33),4,6,20(31),21,23,26,28-nonaene-9,11,17-trione |
| SMILES | CC12Oc3ccc(cc3NC1=O)Nc1nc(ncc1F)Nc1cccc(c1)CCC(=O)NCCCNC2=O |
| InChI | InChI=1S/C26H26FN7O4/c1-26-23(36)29-11-3-10-28-21(35)9-6-15-4-2-5-16(12-15)32-25-30-14-18(27)22(34-25)31-17-7-8-20(38-26)19(13-17)33-24(26)37/h2,4-5,7-8,12-14H,3,6,9-11H2,1H3,(H,28,35)(H,29,36)(H,33,37)(H2,30,31,32,34) |
| InChIKey | MKPMVBADCCMJLO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 146.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.54 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|