C24H20FN3O3 — CID 157304805
23-fluoro-10-methyl-26-oxa-2,21,24-triazapentacyclo[18.3.1.13,7.16,10.114,18]heptacosa-1(24),3(27),4,6,14(25),15,17,20,22-nonaene-9,11-dione (PubChem CID 157304805) has the molecular formula C24H20FN3O3 and a molecular weight of 417.44 g/mol. Its IUPAC name is 23-fluoro-10-methyl-26-oxa-2,21,24-triazapentacyclo[18.3.1.13,7.16,10.114,18]heptacosa-1(24),3(27),4,6,14(25),15,17,20,22-nonaene-9,11-dione.
| Compound Name | 23-fluoro-10-methyl-26-oxa-2,21,24-triazapentacyclo[18.3.1.13,7.16,10.114,18]heptacosa-1(24),3(27),4,6,14(25),15,17,20,22-nonaene-9,11-dione |
|---|---|
| PubChem CID | 157304805 |
| Molecular Formula | C24H20FN3O3 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 23-fluoro-10-methyl-26-oxa-2,21,24-triazapentacyclo[18.3.1.13,7.16,10.114,18]heptacosa-1(24),3(27),4,6,14(25),15,17,20,22-nonaene-9,11-dione |
| SMILES | CC12Oc3ccc(cc3CC1=O)Nc1nc(ncc1F)Cc1cccc(c1)CCC2=O |
| InChI | InChI=1S/C24H20FN3O3/c1-24-20(29)8-5-14-3-2-4-15(9-14)10-22-26-13-18(25)23(28-22)27-17-6-7-19(31-24)16(11-17)12-21(24)30/h2-4,6-7,9,11,13H,5,8,10,12H2,1H3,(H,26,27,28) |
| InChIKey | BCIGLAGMMORQNE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|