C18H17N5 — CID 66897610
2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9(21),10,12,16(20),17-nonaen-12-amine (PubChem CID 66897610) has the molecular formula C18H17N5 and a molecular weight of 303.37 g/mol. Its IUPAC name is 2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9(21),10,12,16(20),17-nonaen-12-amine.
| Compound Name | 2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9(21),10,12,16(20),17-nonaen-12-amine |
|---|---|
| PubChem CID | 66897610 |
| Molecular Formula | C18H17N5 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2,4,8,22-tetrazatetracyclo[14.3.1.13,7.19,13]docosa-1(19),3,5,7(22),9(21),10,12,16(20),17-nonaen-12-amine |
| SMILES | Nc1ccc2cc1CCc1cccc(c1)Nc1nccc(n1)N2 |
| InChI | InChI=1S/C18H17N5/c19-16-7-6-15-11-13(16)5-4-12-2-1-3-14(10-12)22-18-20-9-8-17(21-15)23-18/h1-3,6-11H,4-5,19H2,(H2,20,21,22,23) |
| InChIKey | JJCKADKUZFYABU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|