C19H18N3O4S+ — CID 7095899
6-methyl-2-[(2-oxochromene-3-carbonyl)amino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxamide (PubChem CID 7095899) has the molecular formula C19H18N3O4S+ and a molecular weight of 384.44 g/mol. Its IUPAC name is 6-methyl-2-[(2-oxochromene-3-carbonyl)amino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxamide.
| Compound Name | 6-methyl-2-[(2-oxochromene-3-carbonyl)amino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxamide |
|---|---|
| PubChem CID | 7095899 |
| Molecular Formula | C19H18N3O4S+ |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 6-methyl-2-[(2-oxochromene-3-carbonyl)amino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxamide |
| SMILES | C[NH+]1CCc2c(sc(NC(=O)c3cc4ccccc4oc3=O)c2C(N)=O)C1 |
| InChI | InChI=1S/C19H17N3O4S/c1-22-7-6-11-14(9-22)27-18(15(11)16(20)23)21-17(24)12-8-10-4-2-3-5-13(10)26-19(12)25/h2-5,8H,6-7,9H2,1H3,(H2,20,23)(H,21,24)/p+1 |
| InChIKey | XCNVKLRFLIWWGT-UHFFFAOYSA-O |
| XLogP | 0.78 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|