C21H19IN4O2 — CID 70961261
N-[4-[[1-(4-cyano-3-iodophenyl)-3,5-dimethylpyrazol-4-yl]methoxy]phenyl]acetamide (PubChem CID 70961261) has the molecular formula C21H19IN4O2 and a molecular weight of 486.31 g/mol. Its IUPAC name is N-[4-[[1-(4-cyano-3-iodophenyl)-3,5-dimethylpyrazol-4-yl]methoxy]phenyl]acetamide.
| Compound Name | N-[4-[[1-(4-cyano-3-iodophenyl)-3,5-dimethylpyrazol-4-yl]methoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 70961261 |
| Molecular Formula | C21H19IN4O2 |
| Molecular Weight | 486.31 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | N-[4-[[1-(4-cyano-3-iodophenyl)-3,5-dimethylpyrazol-4-yl]methoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(OCc2c(C)nn(-c3ccc(C#N)c(I)c3)c2C)cc1 |
| InChI | InChI=1S/C21H19IN4O2/c1-13-20(12-28-19-8-5-17(6-9-19)24-15(3)27)14(2)26(25-13)18-7-4-16(11-23)21(22)10-18/h4-10H,12H2,1-3H3,(H,24,27) |
| InChIKey | CDZIMRPQXWNDKG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|