C18H21N7O6S2 — CID 70962308
N-[3-[4-(3-methylbutyl)-5,7-dioxo-[1,2,4]triazolo[1,5-a]pyrimidin-6-ylidene]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide (PubChem CID 70962308) has the molecular formula C18H21N7O6S2 and a molecular weight of 495.54 g/mol. Its IUPAC name is N-[3-[4-(3-methylbutyl)-5,7-dioxo-[1,2,4]triazolo[1,5-a]pyrimidin-6-ylidene]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide.
| Compound Name | N-[3-[4-(3-methylbutyl)-5,7-dioxo-[1,2,4]triazolo[1,5-a]pyrimidin-6-ylidene]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 70962308 |
| Molecular Formula | C18H21N7O6S2 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | N-[3-[4-(3-methylbutyl)-5,7-dioxo-[1,2,4]triazolo[1,5-a]pyrimidin-6-ylidene]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
| SMILES | CC(C)CCn1c(=O)c(=C2Nc3ccc(NS(C)(=O)=O)cc3S(=O)(=O)N2)c(=O)n2ncnc12 |
| InChI | InChI=1S/C18H21N7O6S2/c1-10(2)6-7-24-16(26)14(17(27)25-18(24)19-9-20-25)15-21-12-5-4-11(22-32(3,28)29)8-13(12)33(30,31)23-15/h4-5,8-10,21-23H,6-7H2,1-3H3 |
| InChIKey | UAEAKXYNZLYWNA-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 173.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |