C16H29N3 — CID 70962983
N',N'-dimethyl-N-[5-(3-methylpentan-3-yl)-2-pyridinyl]propane-1,3-diamine (PubChem CID 70962983) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is N',N'-dimethyl-N-[5-(3-methylpentan-3-yl)-2-pyridinyl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[5-(3-methylpentan-3-yl)-2-pyridinyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 70962983 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | N',N'-dimethyl-N-[5-(3-methylpentan-3-yl)-2-pyridinyl]propane-1,3-diamine |
| SMILES | CCC(C)(CC)c1ccc(NCCCN(C)C)nc1 |
| InChI | InChI=1S/C16H29N3/c1-6-16(3,7-2)14-9-10-15(18-13-14)17-11-8-12-19(4)5/h9-10,13H,6-8,11-12H2,1-5H3,(H,17,18) |
| InChIKey | NXTFFWFCTTVTDG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|