C22H24N4O3S2 — CID 70963364
1-phenyl-2-[[6-(4-thiomorpholin-4-ylsulfonylphenyl)pyrimidin-4-yl]amino]ethanol (PubChem CID 70963364) has the molecular formula C22H24N4O3S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 1-phenyl-2-[[6-(4-thiomorpholin-4-ylsulfonylphenyl)pyrimidin-4-yl]amino]ethanol.
| Compound Name | 1-phenyl-2-[[6-(4-thiomorpholin-4-ylsulfonylphenyl)pyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 70963364 |
| Molecular Formula | C22H24N4O3S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 1-phenyl-2-[[6-(4-thiomorpholin-4-ylsulfonylphenyl)pyrimidin-4-yl]amino]ethanol |
| SMILES | O=S(=O)(c1ccc(-c2cc(NCC(O)c3ccccc3)ncn2)cc1)N1CCSCC1 |
| InChI | InChI=1S/C22H24N4O3S2/c27-21(18-4-2-1-3-5-18)15-23-22-14-20(24-16-25-22)17-6-8-19(9-7-17)31(28,29)26-10-12-30-13-11-26/h1-9,14,16,21,27H,10-13,15H2,(H,23,24,25) |
| InChIKey | RTLDGQUCSMBPBG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |