C29H22FN5O — CID 70964233
3-(4-fluorophenyl)-N-[4-(indazol-2-ylmethyl)phenyl]-2-methylbenzimidazole-5-carboxamide (PubChem CID 70964233) has the molecular formula C29H22FN5O and a molecular weight of 475.53 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[4-(indazol-2-ylmethyl)phenyl]-2-methylbenzimidazole-5-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-[4-(indazol-2-ylmethyl)phenyl]-2-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 70964233 |
| Molecular Formula | C29H22FN5O |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[4-(indazol-2-ylmethyl)phenyl]-2-methylbenzimidazole-5-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)Nc3ccc(Cn4cc5ccccc5n4)cc3)cc2n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C29H22FN5O/c1-19-31-27-15-8-21(16-28(27)35(19)25-13-9-23(30)10-14-25)29(36)32-24-11-6-20(7-12-24)17-34-18-22-4-2-3-5-26(22)33-34/h2-16,18H,17H2,1H3,(H,32,36) |
| InChIKey | HXQVYIIVIOFAGA-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |