C16H21F2NO — CID 70966130
(3R,4S)-3-(2,4-difluorophenyl)-4-methyl-1-(oxan-4-yl)pyrrolidine (PubChem CID 70966130) has the molecular formula C16H21F2NO and a molecular weight of 281.35 g/mol. Its IUPAC name is (3R,4S)-3-(2,4-difluorophenyl)-4-methyl-1-(oxan-4-yl)pyrrolidine.
| Compound Name | (3R,4S)-3-(2,4-difluorophenyl)-4-methyl-1-(oxan-4-yl)pyrrolidine |
|---|---|
| PubChem CID | 70966130 |
| Molecular Formula | C16H21F2NO |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (3R,4S)-3-(2,4-difluorophenyl)-4-methyl-1-(oxan-4-yl)pyrrolidine |
| SMILES | C[C@@H]1CN(C2CCOCC2)C[C@H]1c1ccc(F)cc1F |
| InChI | InChI=1S/C16H21F2NO/c1-11-9-19(13-4-6-20-7-5-13)10-15(11)14-3-2-12(17)8-16(14)18/h2-3,8,11,13,15H,4-7,9-10H2,1H3/t11-,15-/m1/s1 |
| InChIKey | HRFBHODXGWOAJF-IAQYHMDHSA-N |
| XLogP | 3.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |