C15H20FNO3 — CID 110159212
(3R,4R)-4-(3-fluorophenoxy)-1-(oxan-4-yl)pyrrolidin-3-ol (PubChem CID 110159212) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is (3R,4R)-4-(3-fluorophenoxy)-1-(oxan-4-yl)pyrrolidin-3-ol.
| Compound Name | (3R,4R)-4-(3-fluorophenoxy)-1-(oxan-4-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 110159212 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (3R,4R)-4-(3-fluorophenoxy)-1-(oxan-4-yl)pyrrolidin-3-ol |
| SMILES | O[C@@H]1CN(C2CCOCC2)C[C@H]1Oc1cccc(F)c1 |
| InChI | InChI=1S/C15H20FNO3/c16-11-2-1-3-13(8-11)20-15-10-17(9-14(15)18)12-4-6-19-7-5-12/h1-3,8,12,14-15,18H,4-7,9-10H2/t14-,15-/m1/s1 |
| InChIKey | OHQMDFHEVRSJTD-HUUCEWRRSA-N |
| XLogP | 1.43 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |