C18H26FNO2 — CID 155992863
(3R,4S)-4-[(3-fluorophenyl)methyl]-3-methoxy-1-(oxan-4-yl)piperidine (PubChem CID 155992863) has the molecular formula C18H26FNO2 and a molecular weight of 307.41 g/mol. Its IUPAC name is (3R,4S)-4-[(3-fluorophenyl)methyl]-3-methoxy-1-(oxan-4-yl)piperidine.
| Compound Name | (3R,4S)-4-[(3-fluorophenyl)methyl]-3-methoxy-1-(oxan-4-yl)piperidine |
|---|---|
| PubChem CID | 155992863 |
| Molecular Formula | C18H26FNO2 |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (3R,4S)-4-[(3-fluorophenyl)methyl]-3-methoxy-1-(oxan-4-yl)piperidine |
| SMILES | CO[C@H]1CN(C2CCOCC2)CC[C@@H]1Cc1cccc(F)c1 |
| InChI | InChI=1S/C18H26FNO2/c1-21-18-13-20(17-6-9-22-10-7-17)8-5-15(18)11-14-3-2-4-16(19)12-14/h2-4,12,15,17-18H,5-11,13H2,1H3/t15-,18+/m1/s1 |
| InChIKey | ZDPVFHNDWWEHNV-QAPCUYQASA-N |
| XLogP | 2.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |