[2-(2-chlorophenyl)-4-propyl-1,3-oxazol-5-yl] hydrogen carbonate

C13H12ClNO4 — CID 70968191

IUPAC[2-(2-chlorophenyl)-4-propyl-1,3-oxazol-5-yl] hydrogen carbonate
SMILESCCCc1nc(-c2ccccc2Cl)oc1OC(=O)O
InChIInChI=1S/C13H12ClNO4/c1-2-5-10-12(19-13(16)17)18-11(15-10)8-6-3-4-7-9(8)14/h3-4,6-7H,2,5H2,1H3,(H,16,17)
InChIKeyOHMQAVQTINDZBL-UHFFFAOYSA-N
MW281.69 g/mol
LogP4.00
Rot. Bonds4

About [2-(2-chlorophenyl)-4-propyl-1,3-oxazol-5-yl] hydrogen carbonate

[2-(2-chlorophenyl)-4-propyl-1,3-oxazol-5-yl] hydrogen carbonate (PubChem CID 70968191) has the molecular formula C13H12ClNO4 and a molecular weight of 281.69 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-4-propyl-1,3-oxazol-5-yl] hydrogen carbonate.

Molecular Properties

Compound Name[2-(2-chlorophenyl)-4-propyl-1,3-oxazol-5-yl] hydrogen carbonate
PubChem CID70968191
Molecular FormulaC13H12ClNO4
Molecular Weight281.69 g/mol
Exact Mass281.05
IUPAC Name[2-(2-chlorophenyl)-4-propyl-1,3-oxazol-5-yl] hydrogen carbonate
SMILESCCCc1nc(-c2ccccc2Cl)oc1OC(=O)O
InChIInChI=1S/C13H12ClNO4/c1-2-5-10-12(19-13(16)17)18-11(15-10)8-6-3-4-7-9(8)14/h3-4,6-7H,2,5H2,1H3,(H,16,17)
InChIKeyOHMQAVQTINDZBL-UHFFFAOYSA-N
XLogP4.00
TPSA72.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.69
LogP ≤ 54.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze [2-(2-chlorophenyl)-4-propyl-1,3-oxazol-5-yl] hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(2-chlorophenyl)-4-propyl-1,3-oxazol-5-yl] hydrogen carbonate?
The IUPAC name of [2-(2-chlorophenyl)-4-propyl-1,3-oxazol-5-yl] hydrogen carbonate (CID 70968191) is [2-(2-chlorophenyl)-4-propyl-1,3-oxazol-5-yl] hydrogen carbonate.
What is the SMILES notation for [2-(2-chlorophenyl)-4-propyl-1,3-oxazol-5-yl] hydrogen carbonate?
The canonical SMILES for [2-(2-chlorophenyl)-4-propyl-1,3-oxazol-5-yl] hydrogen carbonate is CCCc1nc(-c2ccccc2Cl)oc1OC(=O)O.
What is the InChIKey of [2-(2-chlorophenyl)-4-propyl-1,3-oxazol-5-yl] hydrogen carbonate?
The InChIKey is OHMQAVQTINDZBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClNO4/c1-2-5-10-12(19-13(16)17)18-11(15-10)8-6-3-4-7-9(8)14/h3-4,6-7H,2,5H2,1H3,(H,16,17).
What are the key properties of [2-(2-chlorophenyl)-4-propyl-1,3-oxazol-5-yl] hydrogen carbonate?
[2-(2-chlorophenyl)-4-propyl-1,3-oxazol-5-yl] hydrogen carbonate has a molecular weight of 281.69 g/mol, XLogP of 4.00, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-chlorophenyl)-4-propyl-1,3-oxazol-5-yl] hydrogen carbonate is sourced from PubChem (CID 70968191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).