C21H28FN4O6S- — CID 70969815
2-[[2-[[1-[[(2R)-1,4-dioxan-2-yl]methyl]-7-fluoroindazole-3-carbonyl]amino]-3,3-dimethylbutanoyl]amino]ethanesulfinate (PubChem CID 70969815) has the molecular formula C21H28FN4O6S- and a molecular weight of 483.54 g/mol. Its IUPAC name is 2-[[2-[[1-[[(2R)-1,4-dioxan-2-yl]methyl]-7-fluoroindazole-3-carbonyl]amino]-3,3-dimethylbutanoyl]amino]ethanesulfinate.
| Compound Name | 2-[[2-[[1-[[(2R)-1,4-dioxan-2-yl]methyl]-7-fluoroindazole-3-carbonyl]amino]-3,3-dimethylbutanoyl]amino]ethanesulfinate |
|---|---|
| PubChem CID | 70969815 |
| Molecular Formula | C21H28FN4O6S- |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 2-[[2-[[1-[[(2R)-1,4-dioxan-2-yl]methyl]-7-fluoroindazole-3-carbonyl]amino]-3,3-dimethylbutanoyl]amino]ethanesulfinate |
| SMILES | CC(C)(C)C(NC(=O)c1nn(C[C@@H]2COCCO2)c2c(F)cccc12)C(=O)NCCS(=O)[O-] |
| InChI | InChI=1S/C21H29FN4O6S/c1-21(2,3)18(20(28)23-7-10-33(29)30)24-19(27)16-14-5-4-6-15(22)17(14)26(25-16)11-13-12-31-8-9-32-13/h4-6,13,18H,7-12H2,1-3H3,(H,23,28)(H,24,27)(H,29,30)/p-1/t13-,18?/m1/s1 |
| InChIKey | FYHBNFXKLRYFGE-YJJYDOSJSA-M |
| XLogP | 0.73 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|