C22H25F2N5O5 — CID 70970069
N-[[2-[(3,4-difluorophenyl)methylcarbamoyl]-3-hydroxy-4-oxo-7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-8-yl]methyl]-N',N'-dimethyloxamide (PubChem CID 70970069) has the molecular formula C22H25F2N5O5 and a molecular weight of 477.47 g/mol. Its IUPAC name is N-[[2-[(3,4-difluorophenyl)methylcarbamoyl]-3-hydroxy-4-oxo-7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-8-yl]methyl]-N',N'-dimethyloxamide.
| Compound Name | N-[[2-[(3,4-difluorophenyl)methylcarbamoyl]-3-hydroxy-4-oxo-7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-8-yl]methyl]-N',N'-dimethyloxamide |
|---|---|
| PubChem CID | 70970069 |
| Molecular Formula | C22H25F2N5O5 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-[[2-[(3,4-difluorophenyl)methylcarbamoyl]-3-hydroxy-4-oxo-7,8,9,10-tetrahydro-6H-pyrimido[1,2-a]azepin-8-yl]methyl]-N',N'-dimethyloxamide |
| SMILES | CN(C)C(=O)C(=O)NCC1CCc2nc(C(=O)NCc3ccc(F)c(F)c3)c(O)c(=O)n2CC1 |
| InChI | InChI=1S/C22H25F2N5O5/c1-28(2)22(34)20(32)26-10-12-4-6-16-27-17(18(30)21(33)29(16)8-7-12)19(31)25-11-13-3-5-14(23)15(24)9-13/h3,5,9,12,30H,4,6-8,10-11H2,1-2H3,(H,25,31)(H,26,32) |
| InChIKey | VTFFOWADHGPJEX-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|