C24H28FN5O5 — CID 91382525
N-[(10R)-4-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[8.2.1.02,7]trideca-2,4-dien-12-yl]-N',N'-dimethyloxamide (PubChem CID 91382525) has the molecular formula C24H28FN5O5 and a molecular weight of 485.52 g/mol. Its IUPAC name is N-[(10R)-4-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[8.2.1.02,7]trideca-2,4-dien-12-yl]-N',N'-dimethyloxamide.
| Compound Name | N-[(10R)-4-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[8.2.1.02,7]trideca-2,4-dien-12-yl]-N',N'-dimethyloxamide |
|---|---|
| PubChem CID | 91382525 |
| Molecular Formula | C24H28FN5O5 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | N-[(10R)-4-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[8.2.1.02,7]trideca-2,4-dien-12-yl]-N',N'-dimethyloxamide |
| SMILES | Cc1cc(CNC(=O)c2nc3n(c(=O)c2O)CC[C@@H]2CC(NC(=O)C(=O)N(C)C)C3C2)ccc1F |
| InChI | InChI=1S/C24H28FN5O5/c1-12-8-14(4-5-16(12)25)11-26-21(32)18-19(31)23(34)30-7-6-13-9-15(20(30)28-18)17(10-13)27-22(33)24(35)29(2)3/h4-5,8,13,15,17,31H,6-7,9-11H2,1-3H3,(H,26,32)(H,27,33)/t13-,15?,17?/m0/s1 |
| InChIKey | MJFOCJHMMPNIGT-KTAKPFMOSA-N |
| XLogP | 0.80 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|