C25H29FN6O6 — CID 91609296
N-[4-[[4-fluoro-2-(methylcarbamoyl)phenyl]methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-11-yl]-N',N'-dimethyloxamide (PubChem CID 91609296) has the molecular formula C25H29FN6O6 and a molecular weight of 528.54 g/mol. Its IUPAC name is N-[4-[[4-fluoro-2-(methylcarbamoyl)phenyl]methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-11-yl]-N',N'-dimethyloxamide.
| Compound Name | N-[4-[[4-fluoro-2-(methylcarbamoyl)phenyl]methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-11-yl]-N',N'-dimethyloxamide |
|---|---|
| PubChem CID | 91609296 |
| Molecular Formula | C25H29FN6O6 |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | N-[4-[[4-fluoro-2-(methylcarbamoyl)phenyl]methylcarbamoyl]-5-hydroxy-6-oxo-3,7-diazatricyclo[7.2.2.02,7]trideca-2,4-dien-11-yl]-N',N'-dimethyloxamide |
| SMILES | CNC(=O)c1cc(F)ccc1CNC(=O)c1nc2n(c(=O)c1O)CC1CCC2C(NC(=O)C(=O)N(C)C)C1 |
| InChI | InChI=1S/C25H29FN6O6/c1-27-21(34)16-9-14(26)6-5-13(16)10-28-22(35)18-19(33)24(37)32-11-12-4-7-15(20(32)30-18)17(8-12)29-23(36)25(38)31(2)3/h5-6,9,12,15,17,33H,4,7-8,10-11H2,1-3H3,(H,27,34)(H,28,35)(H,29,36) |
| InChIKey | HXCUEPLJEGWWMN-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|