C23H28FN5O6 — CID 54748155
N'-[(6R,10R)-2-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-3-hydroxy-6-methyl-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-10-yl]-N,N,N'-trimethyloxamide (PubChem CID 54748155) has the molecular formula C23H28FN5O6 and a molecular weight of 489.50 g/mol. Its IUPAC name is N'-[(6R,10R)-2-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-3-hydroxy-6-methyl-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-10-yl]-N,N,N'-trimethyloxamide.
| Compound Name | N'-[(6R,10R)-2-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-3-hydroxy-6-methyl-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-10-yl]-N,N,N'-trimethyloxamide |
|---|---|
| PubChem CID | 54748155 |
| Molecular Formula | C23H28FN5O6 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | N'-[(6R,10R)-2-[(4-fluoro-3-methylphenyl)methylcarbamoyl]-3-hydroxy-6-methyl-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepin-10-yl]-N,N,N'-trimethyloxamide |
| SMILES | Cc1cc(CNC(=O)c2nc3n(c(=O)c2O)[C@H](C)COC[C@@H]3N(C)C(=O)C(=O)N(C)C)ccc1F |
| InChI | InChI=1S/C23H28FN5O6/c1-12-8-14(6-7-15(12)24)9-25-20(31)17-18(30)21(32)29-13(2)10-35-11-16(19(29)26-17)28(5)23(34)22(33)27(3)4/h6-8,13,16,30H,9-11H2,1-5H3,(H,25,31)/t13-,16+/m1/s1 |
| InChIKey | LYGRPBCSEZRRMB-CJNGLKHVSA-N |
| XLogP | 0.51 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|