C18H20FN3O4 — CID 143973229
(6R)-N-[(4-fluoro-3-methylphenyl)methyl]-3-hydroxy-6-methyl-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepine-2-carboxamide (PubChem CID 143973229) has the molecular formula C18H20FN3O4 and a molecular weight of 361.37 g/mol. Its IUPAC name is (6R)-N-[(4-fluoro-3-methylphenyl)methyl]-3-hydroxy-6-methyl-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepine-2-carboxamide.
| Compound Name | (6R)-N-[(4-fluoro-3-methylphenyl)methyl]-3-hydroxy-6-methyl-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepine-2-carboxamide |
|---|---|
| PubChem CID | 143973229 |
| Molecular Formula | C18H20FN3O4 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (6R)-N-[(4-fluoro-3-methylphenyl)methyl]-3-hydroxy-6-methyl-4-oxo-6,7,9,10-tetrahydropyrimido[1,2-d][1,4]oxazepine-2-carboxamide |
| SMILES | Cc1cc(CNC(=O)c2nc3n(c(=O)c2O)[C@H](C)COCC3)ccc1F |
| InChI | InChI=1S/C18H20FN3O4/c1-10-7-12(3-4-13(10)19)8-20-17(24)15-16(23)18(25)22-11(2)9-26-6-5-14(22)21-15/h3-4,7,11,23H,5-6,8-9H2,1-2H3,(H,20,24)/t11-/m1/s1 |
| InChIKey | QZSVFOKMVJAMPR-LLVKDONJSA-N |
| XLogP | 1.46 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |